2832998-22-6
Chemical Structure
Uric acid-13C3
- CAS No.: 2832998-22-6
- Formula:C213C3H4N4O3
- Molecular Weight:171.09
InChIKey: LEHOTFFKMJEONL-VMIGTVKRSA-N
SMILES: O=[13C]1[13C]2=[13C](NC(N2)=O)NC(N1)=O
Biological Activity: Uric acid-13C3 is 13C-labeled Uric acid (HY-B2130). Uric acid is the end product of purine metabolism in the human body. Uric acid can scavenge reactive oxygen species (ROS), such as singlet oxygen and peroxynitrite, and inhibit lipid peroxidation.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Uric acid-13C3 | Uric acid-13C3 is 13C-labeled Uric acid (HY-B2130). Uric acid is the end product of purine metabolism in the human body. Uric acid can scavenge reactive oxygen species (ROS), such as singlet oxygen and peroxynitrite, and inhibit lipid peroxidation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords