2849340-59-4
Chemical Structure
p53 Activator 7
- CAS No.: 2849340-59-4
- Formula:C27H32F3N4OP
- Molecular Weight:516.54
IUPAC Name: dimethyl(4-((3-(4-((1-methylpiperidin-4-yl)amino)-1-(2,2,2-trifluoroethyl)-1H-indol-2-yl)prop-2-yn-1-yl)amino)phenyl)phosphine oxide
InChIKey: TWHPNHHZQSJOEI-UHFFFAOYSA-N
SMILES: FC(F)(F)CN1C2=C(C(NC3CCN(CC3)C)=CC=C2)C=C1C#CCNC4=CC=C(P(C)(C)=O)C=C4
Biological Activity: p53 Activator 7 is a p53 mutation Y220C (MDM-2/p53) activator with an EC50 of 104 nM. p53 Activator 7 can bind to p53 mutant and restore its ability to bind DNA (WO2022213975A1; Example B-1)[1]. p53 Activator 7 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
p53 Activator 7 | 98.22% | p53 Activator 7 is a p53 mutation Y220C (MDM-2/p53) activator with an EC50 of 104 nM. p53 Activator 7 can bind to p53 mutant and restore its ability to bind DNA (WO2022213975A1; Example B-1). p53 Activator 7 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||