2894135-52-3
Chemical Structure
N3-PEG4-amido-Lys(Fmoc)-acid
Synonym(s): Fmoc-Lys(PEG4-N3)-OH
- CAS No.: 2894135-52-3
- Formula:C32H43N5O9
- Molecular Weight:641.71
IUPAC Name: (S)-21-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-1-azido-15-oxo-3,6,9,12-tetraoxa-16-azadocosan-22-oic acid
InChIKey: JYTFGMAXFXMYNK-LJAQVGFWSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCC(NCCCC[C@@H](C(O)=O)NC(OCC1C2=CC=CC=C2C3=CC=CC=C31)=O)=O
Biological Activity: N3-PEG4-amido-Lys(Fmoc)-acid is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. N3-PEG4-amido-Lys(Fmoc)-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-PEG4-amido-Lys(Fmoc)-acid | N3-PEG4-amido-Lys(Fmoc)-acid is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). N3-PEG4-amido-Lys(Fmoc)-acid is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||