2912307-39-0
Chemical Structure
PROTAC PTPN2 degrader-2 TFA
- CAS No.: 2912307-39-0
- Formula:C51H50ClF3N6O13S2
- Molecular Weight:1111.55
InChIKey: RXQQQCZMVRJVJE-PRLOVNCOSA-N
SMILES: O=C1C2=C3C(N1[C@@H]4C(NC(CC4)=O)=O)=CC=C(C5CCN(CC5)C(NC6=CC(CS(=O)(N7C(C)(C[C@H](CC7)NC8=CC(C9=C(C(OCC(O)=O)=C(S9)C(O)=O)Cl)=CC=C8)C)=O)=CC=C6)=O)C3=CC=C2.OC(C(F)(F)F)=O
Biological Activity: PROTAC PTPN2 degrader-2 TFA is a potent PTPN2 PROTAC degrader with a DC50 of <50 nM. PROTAC PTPN2 degrader-2 TFA is potential for studying cancer or metabolic diseases, such as colon cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PROTAC PTPN2 degrader-2 TFA | PROTAC PTPN2 degrader-2 TFA is a potent PTPN2 PROTAC degrader with a DC50 of <50 nM. PROTAC PTPN2 degrader-2 TFA is potential for studying cancer or metabolic diseases, such as colon cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||