297-76-7
297-76-7
Chemical Structure
Ethynodiol diacetate
Synonym(s): Ethynodiol acetate
- CAS No.: 297-76-7
- Formula:C24H32O4
- Molecular Weight:384.51
IUPAC Name: (3S,8R,9S,10R,13S,14S,17R)-17-ethynyl-13-methyl-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,17-diyl diacetate
InChIKey: ONKUMRGIYFNPJW-KIEAKMPYSA-N
SMILES: C#C[C@]1(OC(C)=O)CC[C@@]2([H])[C@]3([H])CCC4=C[C@@H](OC(C)=O)CC[C@]4([H])[C@@]3([H])CC[C@]12C
Biological Activity: Ethynodiol diacetate is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ethynodiol diacetate | 99.85% | Ethynodiol diacetate is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ethynodiol diacetate (Standard) | ≥98% | Ethynodiol diacetate (Standard) is the analytical standard of Ethynodiol diacetate. This product is intended for research and analytical applications. Ethynodiol diacetate is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
