2999673-34-4
Chemical Structure
ZG36
- CAS No.: 2999673-34-4
- Formula:C31H35BrN4O4
- Molecular Weight:607.54
InChIKey: ZFXGQLLQQPADFS-XHGLXQHVSA-N
SMILES: BrC1=CC=C(CNC(N(CC2)[C@]3([H])N([C@H](C(N(C3)CC4=C5C(C=CC=C5)=C(OC)C=C4)=O)[C@H](CC)C)C2=O)=O)C=C1
Biological Activity: ZG36 is a human Caseinolytic protease P (ClpP) agonist. ZG36 non-selectively degrades respiratory chain complexes and reduces mitochondrial DNA, ultimately leading to mitochondrial dysfunction and leukemic cell death. ZG36 also inhibits the development of acute myeloid leukemia in a xenograft mouse model[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
ZG36 | ZG36 is a human Caseinolytic protease P (ClpP) agonist. ZG36 non-selectively degrades respiratory chain complexes and reduces mitochondrial DNA, ultimately leading to mitochondrial dysfunction and leukemic cell death. ZG36 also inhibits the development of acute myeloid leukemia in a xenograft mouse model. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||