3032386-49-2
Chemical Structure
CYP51/PD-L1-IN-1
- CAS. Nr.: 3032386-49-2
- Formula:C20H15N5O2
- Molecular Weight:357.37
InChIKey: LSBBUIAGNZFGEL-UHFFFAOYSA-N
SMILES: O=C(C1=NC2=CC=CC=C2C(N3C=NC=C3)=N1)NC4=CC=C(C(C)=O)C=C4
Biological Activity: CYP51/PD-L1-IN-1 (compound L11) is a quinazoline compound with antifungal activity. CYP51/PD-L1-IN-1 is a dual inhibitor of CYP51 (IC50: 0.884 μM) and PD-L1 (IC50: 0.083 μM), which can induce early apoptosis of fungal cells in the cell cycle. CYP51/PD-L1-IN-1 also significantly reduced intracellular IL-2, NLRP3, and NF-κBp65 protein levels, induced mitochondrial damage and ROS accumulation, and ultimately led to fungal lysis and death[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CYP51/PD-L1-IN-1 | CYP51/PD-L1-IN-1 (compound L11) is a quinazoline compound with antifungal activity. CYP51/PD-L1-IN-1 is a dual inhibitor of CYP51 (IC50: 0.884 μM) and PD-L1 (IC50: 0.083 μM), which can induce early apoptosis of fungal cells in the cell cycle. CYP51/PD-L1-IN-1 also significantly reduced intracellular IL-2, NLRP3, and NF-κBp65 protein levels, induced mitochondrial damage and ROS accumulation, and ultimately led to fungal lysis and death. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||