3033232-87-7
Chemical Structure
JMX0293
- CAS No.: 3033232-87-7
- Formula:C25H30Cl2N4O7
- Molecular Weight:569.43
IUPAC Name: methyl (S)-2-amino-2-(3-bromophenyl)acetate hydrochloride
InChIKey: UYVWMWGFNTXKPF-NRFANRHFSA-N
SMILES: CC([C@H](NC(C1=C(C=CC(Cl)=C1)OCCNC(OC(C)(C)C)=O)=O)C(NC2=C(C=C(C=C2)[N+]([O-])=O)Cl)=O)C
Biological Activity: JMX0293 is an O-alkylamino-tethered salicylamide derivative compound. JMX0293 maintains good potency against MDA-MB-231 cell line (IC50 = 3.38 μM) while exhibiting very low toxicity against human non-tumorigenic breast epithelial cell line MCF-10A (IC50> 60 μM). JMX0293 inhibits STAT3 phosphorylation and contribute to apoptosis in TNBC MDA-MB-231 cells. JMX0293 significantly suppresses MDA-MB-231 xenograft tumor growth in vivo without significant toxicity[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
JMX0293 | JMX0293 is an O-alkylamino-tethered salicylamide derivative compound. JMX0293 maintains good potency against MDA-MB-231 cell line (IC50 = 3.38 μM) while exhibiting very low toxicity against human non-tumorigenic breast epithelial cell line MCF-10A (IC50> 60 μM). JMX0293 inhibits STAT3 phosphorylation and contribute to apoptosis in TNBC MDA-MB-231 cells. JMX0293 significantly suppresses MDA-MB-231 xenograft tumor growth in vivo without significant toxicity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
