3052938-18-5
Chemical Structure
GSPT1 degrader-18
- CAS No.: 3052938-18-5
- Formula:C24H22ClN3O4
- Molecular Weight:451.90
InChIKey: VEQHPGHFQTZYPG-UHFFFAOYSA-N
SMILES: O=C(NC1=CC=C(C)C(Cl)=C1)OCC2=CC3=C(C=C(C4C(NC(CC4)=O)=O)C(C)=N3)C=C2
Biological Activity: GSPT1 degrader-18 is a GSPT1 degrader that inhibits the proliferation of cancer cells. GSPT1 degrader-18 has weak ability to induce the formation of the GSPT1-CRBN/DDB1 ternary complex and belongs to a weak molecular glue. GSPT1 degrader-18 can be used in cancer-related research[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
GSPT1 degrader-18 | GSPT1 degrader-18 is a GSPT1 degrader that inhibits the proliferation of cancer cells. GSPT1 degrader-18 has weak ability to induce the formation of the GSPT1-CRBN/DDB1 ternary complex and belongs to a weak molecular glue. GSPT1 degrader-18 can be used in cancer-related research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||