3061-90-3
Chemical Structure
Alanylphenylalanine
Synonym(s): L-Alanyl-L-phenylalanine; H-Ala-Phe-OH
- CAS No.: 3061-90-3
- Formula:C12H16N2O3
- Molecular Weight:236.27
IUPAC Name: L-alanyl-L-phenylalanine
InChIKey: OMNVYXHOSHNURL-WPRPVWTQSA-N
SMILES: O=C(O)[C@@H](NC([C@@H](N)C)=O)CC1=CC=CC=C1
Biological Activity: Alanylphenylalanine (L-Alanyl-L-phenylalanine) is a dipeptide. Alanylphenylalanine forms a mononuclear Au (III) complex through bidentate coordination via its carboxyl oxygen atom and deprotonated amide nitrogen atom[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Alanylphenylalanine | 99.74% | Alanylphenylalanine (L-Alanyl-L-phenylalanine) is a dipeptide. Alanylphenylalanine forms a mononuclear Au (III) complex through bidentate coordination via its carboxyl oxygen atom and deprotonated amide nitrogen atom. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Alanylphenylalanine (Standard) | ≥98% | Alanylphenylalanine (L-Alanyl-L-phenylalanine) Standard is the analytical standard of Alanylphenylalanine (HY-W012161). This product is intended for research and analytical applications. Alanylphenylalanine (L-Alanyl-L-phenylalanine) is a dipeptide. Alanylphenylalanine forms a mononuclear Au (III) complex through bidentate coordination via its carboxyl oxygen atom and deprotonated amide nitrogen atom. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||