3090710-48-5
Chemical Structure
AS-0017445
- CAS No.: 3090710-48-5
- Formula:C29H30ClN7O2
- Molecular Weight:544.05
InChIKey: NZHXQVFUBRNCET-WRONEBCDSA-N
SMILES: O=C(N(CC1=CN(C)N=N1)C[C@@]23C(N(C4=CN=CC5=C4C=CC=C5)C[C@@H]3CNC(C)C)=O)C6=C2C=C(Cl)C=C6
Biological Activity: AS-0017445 is an inhibitor targeting the main protease of both the current coronavirus and the virus that caused the Middle East Respiratory Syndrome (MERS) outbreak. AS-0017445 inhibits the viral protein processing in host cells and thus prevents viral replication[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
AS-0017445 | AS-0017445 is an inhibitor targeting the main protease of both the current coronavirus and the virus that caused the Middle East Respiratory Syndrome (MERS) outbreak. AS-0017445 inhibits the viral protein processing in host cells and thus prevents viral replication. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||