3091879-60-3
Chemical Structure
Cyanine 7 DBCO chloride
- CAS No.: 3091879-60-3
- Formula:C55H61ClN4O2
- Molecular Weight:845.55
InChIKey: BQZXIUKEYGBXNR-UHFFFAOYSA-N
SMILES: O=C(CCCCCN1C2=C(C(C)(C)/C1=C/C=C/C=C/C=C/C3=[N+](C)C4=C(C3(C)C)C=CC=C4)C=CC=C2)NCCCCCC(N5C6=C(C#CC7=C(C5)C=CC=C7)C=CC=C6)=O.[Cl-]
Biological Activity: Cyanine 7 DBCO chloride is a click chemistry reagent containing an cycloalkynes group. Cyanine 7 DBCO chloride is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability (Ex/Em = 745/785 nm)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cyanine 7 DBCO chloride | Cyanine 7 DBCO chloride is a click chemistry reagent containing an cycloalkynes group. Cyanine 7 DBCO chloride is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability (Ex/Em = 745/785 nm). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||