3103487-72-2
Chemical Structure
Myosin-IN-3
- CAS No.: 3103487-72-2
- Formula:C16H19N5O3
- Molecular Weight:329.35
InChIKey: NQXSAKLSJIJVHB-FTNKSUMCSA-N
SMILES: O=C1C2C(C=CC([C@H](C)NC3=CC(N(C(N3)=O)C(C)C)=O)=C2)=NN1
Biological Activity: Myosin-IN-3 (Compound 4-1) is a pyrimidine ketone derivative. Myosin-IN-3 exhibits significant anti ferroptotic activity (IC50 = 3.11 μM) while possessing myosin (IC50 = 3.09 μM) inhibitory activity and antioxidant activity (DPPH EC50 = 23.17 μM; MDA EC50 = 55.34 μM). Myosin-IN-3 can be used for research on heart conditions such as hypertrophic cardiomyopathy[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Myosin-IN-3 | Myosin-IN-3 (Compound 4-1) is a pyrimidine ketone derivative. Myosin-IN-3 exhibits significant anti ferroptotic activity (IC50 = 3.11 μM) while possessing myosin (IC50 = 3.09 μM) inhibitory activity and antioxidant activity (DPPH EC50 = 23.17 μM; MDA EC50 = 55.34 μM). Myosin-IN-3 can be used for research on heart conditions such as hypertrophic cardiomyopathy. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||