31499-54-4
Chemical Structure
4-Azidobenzyl alcohol
- CAS No.: 31499-54-4
- Formula:C7H7N3O
- Molecular Weight:149.15
IUPAC Name: (S)-2-azido-6-((tert-butoxycarbonyl)amino)hexanoic acid
InChIKey: GEKVUCLUCOBNIE-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NC1=CC=C(CO)C=C1
Biological Activity: 4-Azidobenzyl alcohol is a click chemistry reagent containing an azide group[1]. 4-Azidobenzyl alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Azidobenzyl alcohol | 99.90% | 4-Azidobenzyl alcohol is a click chemistry reagent containing an azide group. 4-Azidobenzyl alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||