315209-19-9
Chemical Structure
Neobulgarone E
- CAS No.: 315209-19-9
- Formula:C32H24Cl2O8
- Molecular Weight:607.43
InChIKey: QAZZAQNQJFRMEL-UHFFFAOYSA-N
SMILES: ClC1=C2C(C3C4=C(Cl)C(O)=CC(O)=C4C(C5=C(OC)C=C(C)C=C53)=O)C6=CC(C)=CC(OC)=C6C(C2=C(C=C1O)O)=O
Biological Activity: Neobulgarone E is an anthraquinone derivative of Neobulgaria pura HA A07-97, a fungus of the ascomycetes class. Neobulgarone E can inhibit the formation of Appressorium in Magnaporthe grisea and has weak cytotoxicity without antifungal, antibacterial or phytotoxicity[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Neobulgarone E | Neobulgarone E is an anthraquinone derivative of Neobulgaria pura HA A07-97, a fungus of the ascomycetes class. Neobulgarone E can inhibit the formation of Appressorium in Magnaporthe grisea and has weak cytotoxicity without antifungal, antibacterial or phytotoxicity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords