31554-34-4
Chemical Structure
Theleganbanin B
- CAS No.: 31554-34-4
- Formula:C26H16O6
- Molecular Weight:424.40
SMILES: O=C(C(C1=CC=C(O)C=C1)=C(O2)C3=C(C4=CC=CC=C4)C2=O)C(O)=C3C5=CC=C(O)C=C5
Biological Activity: Theleganbanin B is a p-terphenyl derivative found in the Thelephora ganbajun. Theleganbanin B inhibits TNF-α, IL-6, and IL-1β production in LPS-induced BV-2 microglial cells. Theleganbanin B inhibits the phosphorylation of JAK2/STAT3. Theleganbanin B is promising for research of neurodegenerative diseases [1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Theleganbanin B | Theleganbanin B is a p-terphenyl derivative found in the Thelephora ganbajun. Theleganbanin B inhibits TNF-α, IL-6, and IL-1β production in LPS-induced BV-2 microglial cells. Theleganbanin B inhibits the phosphorylation of JAK2/STAT3. Theleganbanin B is promising for research of neurodegenerative diseases . | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||