3156-41-0
Chemical Structure
SARS-CoV-2 3CLpro-IN-15
- CAS No.: 3156-41-0
- Formula:C8H6N2O4
- Molecular Weight:194.14
IUPAC Name: (E)-1-nitro-4-(2-nitrovinyl)benzene
InChIKey: HABXLWPUIWFTNM-AATRIKPKSA-N
SMILES: [O-][N+](/C=C/C1=CC=C([N+]([O-])=O)C=C1)=O
Biological Activity: SARS-CoV-2 3CLpro-IN-15 (compound a) is a beta-nitrostyrene coronavirus SARS-CoV-2 inhibitor that targets the SARS-CoV-2 3CL protease (3CLpro). SARS-CoV-2 3CLpro-IN-15 inhibits viral replication and transcription and plays a key role in the discovery of anti-COVID-19 lead compounds[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
SARS-CoV-2 3CLpro-IN-15 | SARS-CoV-2 3CLpro-IN-15 (compound a) is a beta-nitrostyrene coronavirus SARS-CoV-2 inhibitor that targets the SARS-CoV-2 3CL protease (3CLpro). SARS-CoV-2 3CLpro-IN-15 inhibits viral replication and transcription and plays a key role in the discovery of anti-COVID-19 lead compounds. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||