333366-32-8
Chemical Structure
N3-L-Lys(Boc)-OH
- CAS No.: 333366-32-8
- Formula:C11H20N4O4
- Molecular Weight:272.30
IUPAC Name: (S)-2-azido-6-((tert-butoxycarbonyl)amino)hexanoic acid
InChIKey: KROYNWSGVIHIMN-QMMMGPOBSA-N
SMILES: CC(C)(C)OC(NCCCC[C@@H](C(O)=O)N=[N+]=[N-])=O
Biological Activity: N3-L-Lys(Boc)-OH is a click chemistry reagent containing an azide group[1]. N3-L-Lys(Boc)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N3-L-Lys(Boc)-OH | N3-L-Lys(Boc)-OH is a click chemistry reagent containing an azide group. N3-L-Lys(Boc)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||