339337-07-4
Chemical Structure
Primordazine B
- CAS No.: 339337-07-4
- Formula:C18H17N5O2S
- Molecular Weight:367.42
IUPAC Name: 2-((5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)thio)-N-(furan-2-ylmethyl)acetamide
InChIKey: JOMKYSCIYRKSMA-UHFFFAOYSA-N
SMILES: O=C(CSC1=NN=C2C(N(C3=C2C=CC=C3)CC)=N1)NCC4=CC=CO4
Biological Activity: Primordazine B is a small molecule compound identified by chemical screening in zebrafish embryos with the activity of selectively destroying Primordial Germ Cells (PGCs). Primordazine B inhibits a process called Poly(A)-tail Independent Non-canonical Translation (PAINT) without inhibition of polyadenylate tail dependent typical translation (PAT). Primordazine B can be used to study translational control of cells in specific physiological or pathological states, such as gene expression regulation during cell dormancy, viral infection, or stress conditions[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Primordazine B | Primordazine B is a small molecule compound identified by chemical screening in zebrafish embryos with the activity of selectively destroying Primordial Germ Cells (PGCs). Primordazine B inhibits a process called Poly(A)-tail Independent Non-canonical Translation (PAINT) without inhibition of polyadenylate tail dependent typical translation (PAT). Primordazine B can be used to study translational control of cells in specific physiological or pathological states, such as gene expression regulation during cell dormancy, viral infection, or stress conditions. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
