403479-63-0
Chemical Structure
Scyptolin B
- CAS No.: 403479-63-0
- Formula:C52H80ClN9O16
- Molecular Weight:1122.70
SMILES: [H][C@]1([C@@H](C)O)C(N([C@H](C(N[C@H](C(O[C@@H]([C@@H](C(N[C@H](C(N[C@@](CC[C@H](N21)O)(C2=O)[H])=O)CC(C)C)=O)NC([C@H]([C@H](OC([C@@H](NC(CCC)=O)C)=O)C)NC([C@@H](NC(CCC)=O)C)=O)=O)C)=O)C(C)C)=O)CC3=CC(Cl)=C(O)C=C3)C)=O
Biological Activity: Scyptolin B, a cyclic depsipeptides, is a secondary metabolite. Scyptolin B can be isolated from axenic cultures of Scytonema hofmanni PCC 7110. Scyptolin B selective inhibits porcine pancreatic Elastase with an IC50 of 3.1 μg/mL[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Scyptolin B | Scyptolin B, a cyclic depsipeptides, is a secondary metabolite. Scyptolin B can be isolated from axenic cultures of Scytonema hofmanni PCC 7110. Scyptolin B selective inhibits porcine pancreatic Elastase with an IC50 of 3.1 μg/mL. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords