41135-06-2
Chemical Structure
Inophyllum B
Synonym(s): (+)-Inophyllum B
- CAS. Nr.: 41135-06-2
- Formula:C25H24O5
- Molecular Weight:404.46
IUPAC Name: (10R,11S,12S)-12-hydroxy-6,6,10,11-tetramethyl-4-phenyl-11,12-dihydro-2H,6H,10H-dipyrano[2,3-f:2',3'-h]chromen-2-one
InChIKey: BXENDTPSKAICGV-LKBUQDJMSA-N
SMILES: O[C@@H]1C2=C(O[C@@H]([C@H]1C)C)C(C=CC(C)(O3)C)=C3C(C(C4=CC=CC=C4)=C5)=C2OC5=O
Biological Activity: Inophyllum B ((+)-Inophyllum B) is a potent HIV Reverse Transcriptase inhibitor with an IC50 value of 38 nM. Inophyllum B inhibits HIV-1 (IC50=1.4 μM) in vitro cell culture. Inophyllum B can be isolated from the acetone extract of the giant African snail, Achatina fulica[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Inophyllum B | Inophyllum B ((+)-Inophyllum B) is a potent HIV Reverse Transcriptase inhibitor with an IC50 value of 38 nM. Inophyllum B inhibits HIV-1 (IC50=1.4 μM) in vitro cell culture. Inophyllum B can be isolated from the acetone extract of the giant African snail, Achatina fulica. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||