4368-51-8
Chemical Structure
Tetraheptylammonium bromide (>98%,BC)
- CAS No.: 4368-51-8
- Formula:C28H60BrN
- Molecular Weight:490.70
IUPAC Name: Tetraheptylammonium bromide
InChIKey: YQIVQBMEBZGFBY-UHFFFAOYSA-M
SMILES: CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Br-]
Biological Activity: Tetraheptylammonium bromide (>98%,BC) (THAB) is a quaternary ammonium compound commonly used as a phase transfer catalyst in organic synthesis reactions, especially those involving charged species or polar reagents. It can facilitate the transfer of reactants between two immiscible phases, such as water and organic solvents, by forming stable ion pairs. In addition, THAB is used as a surfactant, and as an additive in various products such as cosmetics, pharmaceuticals, and detergents. Due to THAB's ability to form complexes with these ions, its potential use in the removal of heavy metal ions from wastewater was also investigated.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tetraheptylammonium bromide (>98%,BC) | 98.0% | Tetraheptylammonium bromide (>98%,BC) (THAB) is a quaternary ammonium compound commonly used as a phase transfer catalyst in organic synthesis reactions, especially those involving charged species or polar reagents. It can facilitate the transfer of reactants between two immiscible phases, such as water and organic solvents, by forming stable ion pairs. In addition, THAB is used as a surfactant, and as an additive in various products such as cosmetics, pharmaceuticals, and detergents. Due to THAB's ability to form complexes with these ions, its potential use in the removal of heavy metal ions from wastewater was also investigated. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
