5064-31-3
Chemical Structure
Nitrilotriacetic acid trisodium salt
Synonym(s): Triglycollamic acid trisodium salt
- CAS No.: 5064-31-3
- Formula:C6H6NNa3O6
- Molecular Weight:257.08
IUPAC Name: sodium 2,2',2''-nitrilotriacetate
InChIKey: DZCAZXAJPZCSCU-UHFFFAOYSA-K
SMILES: O=C(CN(CC(O[Na])=O)CC(O[Na])=O)O[Na]
Biological Activity: Nitrilotriacetic acid (Triglycollamic acid) trisodium salt is a chelating agent commonly used in various industrial processes, especially in the production of detergents, cleaners and metal plating solutions. Nitrilotriacetic acid trisodium salt has unique chemical properties that bind to metal ions, preventing them from reacting or precipitating out of solution.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Nitrilotriacetic acid trisodium salt | Nitrilotriacetic acid (Triglycollamic acid) trisodium salt is a chelating agent commonly used in various industrial processes, especially in the production of detergents, cleaners and metal plating solutions. Nitrilotriacetic acid trisodium salt has unique chemical properties that bind to metal ions, preventing them from reacting or precipitating out of solution. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||