52646-92-1
Chemical Structure
Anisodine
Synonym(s): Daturamine; α-Hydroxyscopolamine
- CAS No.: 52646-92-1
- Formula:C17H21NO5
- Molecular Weight:319.35
IUPAC Name: (1R,2R,4S,5S,7s)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl (S)-2,3-dihydroxy-2-phenylpropanoate
InChIKey: JEJREKXHLFEVHN-VJDHNPKBSA-N
SMILES: CN1[C@@H](C[C@H](OC([C@@](O)(CO)C2=CC=CC=C2)=O)C[C@H]31)[C@H]4[C@@H]3O4
Biological Activity: Anisodine (Daturamine) is a neuroprotective compound that reduces exacerbated M1, M2, M4, and M5 receptor expression in brain tissues under hypoxia/reoxygenation conditions. Anisodine inhibits calcium ion influx and reactive oxygen species (ROS)levels. Anisodine leads to decreased aspartate levels during hypoxia[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Anisodine | Anisodine (Daturamine) is a neuroprotective compound that reduces exacerbated M1, M2, M4, and M5 receptor expression in brain tissues under hypoxia/reoxygenation conditions. Anisodine inhibits calcium ion influx and reactive oxygen species (ROS)levels. Anisodine leads to decreased aspartate levels during hypoxia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||