52886-36-9
Chemical Structure
Cholic acid-13C
- CAS No.: 52886-36-9
- Formula:C2313CH40O5
- Molecular Weight:409.56
IUPAC Name: (R)-4-((3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic-1-13C acid
InChIKey: BHQCQFFYRZLCQQ-HFINQHRVSA-N
SMILES: O[C@H]1[C@@]2([H])[C@@]3([H])[C@@]([C@@](CC3)([H])[C@H](C)CC[13C](O)=O)([C@H](C[C@]2([H])[C@@]4([C@](C[C@@H](CC4)O)([H])C1)C)O)C
Biological Activity: Cholic acid-13C is the 13C-labeled Cholic acid. Cholic acid is a major primary bile acid produced in the liver and usually conjugated with glycine or taurine. It facilitates fat absorption and cholesterol excretion.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cholic acid-13C | 99.17% | Cholic acid-13C is the 13C-labeled Cholic acid. Cholic acid is a major primary bile acid produced in the liver and usually conjugated with glycine or taurine. It facilitates fat absorption and cholesterol excretion. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cholic acid (Standard) | 99.90% | Cholic acid (Standard) is the analytical standard of Cholic acid. This product is intended for research and analytical applications. Cholic acid is a major primary bile acid produced in the liver and usually conjugated with glycine or taurine. It facilitates fat absorption and cholesterol excretion. Cholic acid is orally active. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cholic acid-d4 | 99.91% | Cholic acid-d4 is the deuterium labeled Cholic acid. Cholic acid is a major primary bile acid produced in the liver and usually conjugated with glycine or taurine. It facilitates fat absorption and cholesterol excretion. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cholic acid-d5 | 99.80% | Cholic acid-d5 is the deuterium labeled Cholic acid. Cholic acid is a major primary bile acid produced in the liver and usually conjugated with glycine or taurine. It facilitates fat absorption and cholesterol excretion. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cholic acid | 99.80% | Cholic acid is a major primary bile acid produced in the liver and usually conjugated with glycine or taurine. It facilitates fat absorption and cholesterol excretion. Cholic acid is orally active. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
