5342-97-2
Chemical Structure
tert-Butyl 3,5-dinitrobenzoate
- CAS No.: 5342-97-2
- Formula:C11H12N2O6
- Molecular Weight:268.23
IUPAC Name: tert-butyl 3,5-dinitrobenzoate
InChIKey: JETCTPYQTQUQPA-UHFFFAOYSA-N
SMILES: CC(C)(C)OC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-]
Biological Activity: Tert-butyl 3,5-dinitrobenzoate is an intermediate or reactant in organic synthesis and can also play a role in drug synthesis, dye preparation and other chemical fields.The nitro functional group of Tert-butyl 3,5-dinitrobenzoate has certain reactivity in organic chemistry and can participate in various reactions, such as electrophilic substitution, aromatic amine reaction, etc[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
tert-Butyl 3,5-dinitrobenzoate | 99.71% | Tert-butyl 3,5-dinitrobenzoate is an intermediate or reactant in organic synthesis and can also play a role in drug synthesis, dye preparation and other chemical fields.The nitro functional group of Tert-butyl 3,5-dinitrobenzoate has certain reactivity in organic chemistry and can participate in various reactions, such as electrophilic substitution, aromatic amine reaction, etc. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||