547-57-9
Chemical Structure
Tropaeolin O
- CAS No.: 547-57-9
- Formula:C12H9N2NaO5S
- Molecular Weight:316.27
IUPAC Name: sodium (E)-4-((2,4-dihydroxyphenyl)diazenyl)benzenesulfonate
InChIKey: COEZWFYORILMOM-IERUDJENSA-M
SMILES: O=S(C1=CC=C(/N=N/C2=CC=C(O)C=C2O)C=C1)(O[Na])=O
Biological Activity: Tropaeolin O is an acidic monoazo dye that undergoes a coupling reaction under pH=10.5 conditions to form a blue disazo dye. Tropaeolin O can be used for the determination of palladium(II), osmium(IV), albumin, and casein[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tropaeolin O | Tropaeolin O is an acidic monoazo dye that undergoes a coupling reaction under pH=10.5 conditions to form a blue disazo dye. Tropaeolin O can be used for the determination of palladium(II), osmium(IV), albumin, and casein. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords