552-02-3
Chemical Structure
Viridiflorol
- CAS No.: 552-02-3
- Formula:C15H26O
- Molecular Weight:222.37
IUPAC Name: (2S,3S)-5-(2-(dimethylamino)ethyl)-2-(4-hydroxyphenyl)-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-3-yl acetate hydrobromide
InChIKey: AYXPYQRXGNDJFU-IMNVLQEYSA-N
SMILES: O[C@@]1(C)CC[C@]2([H])[C@](C2(C)C)([H])[C@]3([H])[C@H](C)CC[C@]13[H]
Biological Activity: Viridiflorol is an active natural molecule with anti-cancer effect. Viridiflorol induces anti-neoplastic effects on breast (MCF-7, IC50 = 10 µM), lung (A549, IC50 = 30 µM), and brain (Daoy, IC50 = 0.1 µM) cancer cells through apoptosis. Viridiflorol can be used for breast, lung, and brain cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Viridiflorol | Viridiflorol is an active natural molecule with anti-cancer effect. Viridiflorol induces anti-neoplastic effects on breast (MCF-7, IC50 = 10 µM), lung (A549, IC50 = 30 µM), and brain (Daoy, IC50 = 0.1 µM) cancer cells through apoptosis. Viridiflorol can be used for breast, lung, and brain cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||