55289-35-5
Chemical Structure
1-Bromo-2-methyl-3-nitrobenzene
- CAS No.: 55289-35-5
- Formula:C7H6BrNO2
- Molecular Weight:216.03
IUPAC Name: 1-bromo-2-methyl-3-nitrobenzene
InChIKey: LYTNSGFSAXWBCA-UHFFFAOYSA-N
SMILES: O=[N+](C1=C(C)C(Br)=CC=C1)[O-]
Biological Activity: 1-Bromo-2-methyl-3-nitrobenzene is an organic synthesis intermediate. 1-Bromo-2-methyl-3-nitrobenzene participates in chemical reactions such as electrophilic substitution and coupling through the bromine atom and nitro group in the molecule, and acts as a synthetic precursor. 1-Bromo-2-methyl-3-nitrobenzene can construct complex molecular structures by relying on the leaving property of bromine and the electron-withdrawing property of nitro group, and can be used in the synthesis of benzimidazole VISTA inhibitors in medicinal chemistry[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
1-Bromo-2-methyl-3-nitrobenzene | 99.50% | 1-Bromo-2-methyl-3-nitrobenzene is an organic synthesis intermediate. 1-Bromo-2-methyl-3-nitrobenzene participates in chemical reactions such as electrophilic substitution and coupling through the bromine atom and nitro group in the molecule, and acts as a synthetic precursor. 1-Bromo-2-methyl-3-nitrobenzene can construct complex molecular structures by relying on the leaving property of bromine and the electron-withdrawing property of nitro group, and can be used in the synthesis of benzimidazole VISTA inhibitors in medicinal chemistry. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
