568-63-8
Chemical Structure
Erythrosin B sodium salt
- CAS No.: 568-63-8
- Formula:C20H6I4Na2O5
- Molecular Weight:879.86
IUPAC Name: sodium 2-(2,4,5,7-tetraiodo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate
InChIKey: IINNWAYUJNWZRM-UHFFFAOYSA-L
SMILES: O=C(C1=CC=CC=C1C2=C3C=C(C(C(I)=C3OC4=C2C=C(C(O[Na])=C4I)I)=O)I)O[Na]
Biological Activity: Erythrosin B sodium salt, is a synthetic azo dye commonly used as a food colorant and textile dye. It is a water-soluble compound that produces a bright red color and is often used to improve the appearance of products. Erythrosin B sodium salt is also used in the textile industry for dyeing wool, silk and leather. However, it has been linked to potentially negative health effects, such as allergic reactions and hyperactivity in children.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Erythrosin B sodium salt | 85.0% | Erythrosin B sodium salt, is a synthetic azo dye commonly used as a food colorant and textile dye. It is a water-soluble compound that produces a bright red color and is often used to improve the appearance of products. Erythrosin B sodium salt is also used in the textile industry for dyeing wool, silk and leather. However, it has been linked to potentially negative health effects, such as allergic reactions and hyperactivity in children. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||