57742-39-9
Chemical Structure
Acedoben-d3
- CAS No.: 57742-39-9
- Formula:C9H6D3NO3
- Molecular Weight:182.19
IUPAC Name: 4-(acetamido-2,2,2-d3)benzoic acid
InChIKey: QCXJEYYXVJIFCE-FIBGUPNXSA-N
SMILES: [2H]C([2H])([2H])C(NC1=CC=C(C=C1)C(O)=O)=O
Biological Activity: Acedoben-d3 is the deuterium labeled Acedoben[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Acedoben-d3 | Acedoben-d3 is the deuterium labeled Acedoben. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Acedoben (Standard) | 99.98% | Acedoben (Standard) is the analytical standard of Acedoben. This product is intended for research and analytical applications. Acedoben is a biochemical agent. Acedoben and iron ions can construct a fast self-assembled coordination complex. The Fe-Ace coordination complex can not only serve as a carrier of tumor antigens, but also enhance antigen-specific anti-tumor immunity due to its inherent adjuvant properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Acedoben | 99.68% | Acedoben is a biochemical agent. Acedoben and iron ions can construct a fast self-assembled coordination complex. The Fe-Ace coordination complex can not only serve as a carrier of tumor antigens, but also enhance antigen-specific anti-tumor immunity due to its inherent adjuvant properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||