57742-39-9
57742-39-9
Chemical Structure
Acedoben-d3
- CAS No.: 57742-39-9
- Formula:C9H6D3NO3
- Molecular Weight:182.19
InChIKey: QCXJEYYXVJIFCE-FIBGUPNXSA-N
SMILES: [2H]C([2H])([2H])C(NC1=CC=C(C=C1)C(O)=O)=O
Biological Activity: Acedoben-d3 is the deuterated-labeled Acedoben (HY-B1250). Acedoben is a biochemical reagent. Acedoben can form a rapidly self-assembled coordination complex with iron ions. The Fe-Ace coordination complex not only serves as a carrier for tumor antigens, but also enhances antigen-specific anti-tumor immunity due to its inherent adjuvant properties[1][2].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Acedoben-d3 | Acedoben-d3 is the deuterated-labeled Acedoben (HY-B1250). Acedoben is a biochemical reagent. Acedoben can form a rapidly self-assembled coordination complex with iron ions. The Fe-Ace coordination complex not only serves as a carrier for tumor antigens, but also enhances antigen-specific anti-tumor immunity due to its inherent adjuvant properties. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Acedoben (Standard) | 99.98% | Acedoben (Standard) is the analytical standard of Acedoben (HY-B1250). This product is intended for research and analytical applications. Acedoben is a biochemical reagent. Acedoben can form a rapidly self-assembled coordination complex with iron ions. The Fe-Ace coordination complex not only serves as a carrier for tumor antigens, but also enhances antigen-specific anti-tumor immunity due to its inherent adjuvant properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Acedoben | 99.68% | Acedoben is a biochemical reagent. Acedoben can form a rapidly self-assembled coordination complex with iron ions. The Fe-Ace coordination complex not only serves as a carrier for tumor antigens, but also enhances antigen-specific anti-tumor immunity due to its inherent adjuvant properties. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Boldon JA, et al. Physicochemical properties of acedoben and its trifluoroacetamido derivative. Results in Chemistry. 2023 Dec;6:101075.
- [2]. Li X, et al. Inosine pranobex‑derived coordination complexes for self‑adjuvant, self‑carrier, and self‑assembled vaccines in cancer immunotherapy. Applied Materials Today. 2024 Aug;39:102299.
