59559-06-7
Chemical Structure
Azido-PEG2-azide
- CAS No.: 59559-06-7
- Formula:C6H12N6O2
- Molecular Weight:200.20
IUPAC Name: 1,2-bis(2-azidoethoxy)ethane
InChIKey: OHZGAFKSAANFAS-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG2-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG2-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG2-azide | 98.11% | Azido-PEG2-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG2-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||