5959-52-4
Chemical Structure
3-Amino-2-naphthoic acid
- CAS No.: 5959-52-4
- Formula:C11H9NO2
- Molecular Weight:187.20
IUPAC Name: 3-Amino-2-naphthoic acid
InChIKey: XFXOLBNQYFRSLQ-UHFFFAOYSA-N
SMILES: NC1=CC2=C(C=CC=C2)C=C1C(O)=O
Biological Activity: 3-Amino-2-naphthoic acid is a derivative of naphthalene and can be used to synthesize other compounds. 3-Amino-2-naphthoic acid is commonly used as the base material for synthesizing various dyes and pigments. 3-Amino-2-naphthoic acid has been developed as a "turn-on" fluorescence probe for the specific detection of the cyanate anion (CNO-)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Amino-2-naphthoic acid | 98.51% | 3-Amino-2-naphthoic acid is a derivative of naphthalene and can be used to synthesize other compounds. 3-Amino-2-naphthoic acid is commonly used as the base material for synthesizing various dyes and pigments. 3-Amino-2-naphthoic acid has been developed as a "turn-on" fluorescence probe for the specific detection of the cyanate anion (CNO-). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||