6198-30-7
Chemical Structure
6-Azauridine triphosphate
Synonym(s): 6-Azauridine 5′-triphosphate
- CAS No.: 6198-30-7
- Formula:C8H14N3O15P3
- Molecular Weight:485.13
InChIKey: NCKFQXVRKKNRBB-SHUUEZRQSA-N
SMILES: OP(OP(OP(O)(OC[C@@H]1[C@@H](O)[C@@H](O)[C@H](N2C(NC(C=N2)=O)=O)O1)=O)(O)=O)(O)=O
Biological Activity: 6-Azauridine triphosphate (6-Azauridine 5′-triphosphate) is a nucleotide analog similar to uridine triphosphate, which can be used to study the mechanism of RNA synthesis and transcription regulation[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6-Azauridine triphosphate | 6-Azauridine triphosphate (6-Azauridine 5′-triphosphate) is a nucleotide analog similar to uridine triphosphate, which can be used to study the mechanism of RNA synthesis and transcription regulation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||