64925-81-1
Chemical Structure
Phomopsin B
- CAS No.: 64925-81-1
- Formula:C36H46N6O12
- Molecular Weight:754.78
SMILES: O=C(N[C@H](C(N[C@H](C(N1CC=C[C@H]1C(N/C(C(N/C(C(O)=O)=C/C(O)=O)=O)=C(C)/CC)=O)=O)[C@@](C)(CC)O2)=O)C(C)=C)[C@@H](NC)[C@@H](O)C3=CC=C(O)C2=C3
Biological Activity: Phomopsin B (Compound 3), a hexapeptide, is a Microtubule depolymerizer. Phomopsin B can be isolated from the fungus Phomopsis Leptostromiformis. Phomopsin B has an antimitotic activity. Phomopsin B can be used for cancers research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phomopsin B | Phomopsin B (Compound 3), a hexapeptide, is a Microtubule depolymerizer. Phomopsin B can be isolated from the fungus Phomopsis Leptostromiformis. Phomopsin B has an antimitotic activity. Phomopsin B can be used for cancers research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords