6539-67-9
Chemical Structure
Reactive yellow 3
- CAS No.: 6539-67-9
- Formula:C21H17ClN8O7S2
- Molecular Weight:592.99
IUPAC Name: (E)-3-((2-acetamido-4-((4-amino-6-chloro-1,3,5-triazin-2-yl)amino)phenyl)diazenyl)naphthalene-1,5-disulfonic acid
InChIKey: ASDREVVGQFYRTH-QVIHXGFCSA-N
SMILES: O=[S](O)(C1=CC=CC(C([S](=O)(O)=O)=C2)=C1C=C2/N=N/C(C=CC(NC3=NC(N)=NC(Cl)=N3)=C4)=C4NC(C)=O)=O
Biological Activity: Reactive yellow 3 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Reactive yellow 3 | Reactive yellow 3 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||