660-27-5
Chemical Structure
Diisopropylammonium dichloroacetate
Synonym(s): DIPA; Diisopropylamine dichloroacetate
- No. CAS: 660-27-5
- Formula:C8H17Cl2NO2
- Molecular Weight:230.13
IUPAC Name: diisopropylamine 2,2-dichloroacetate
InChIKey: ILKBHIBYKSHTKQ-UHFFFAOYSA-N
SMILES: O=C(O)C(Cl)Cl.CC(NC(C)C)C
Biological Activity: Diisopropylammonium dichloroacetate is an organic compound commonly used as a catalyst and ligand for organic reactions. It can promote various organic chemical reactions, such as olefin addition, carbonylation reaction and asymmetric catalytic reaction, etc. In addition, the compound is also widely used in the research of some medical fields, for example, in the application of anti-tumor therapy.
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Diisopropylammonium dichloroacetate | 98.0% | Diisopropylammonium dichloroacetate is an organic compound commonly used as a catalyst and ligand for organic reactions. It can promote various organic chemical reactions, such as olefin addition, carbonylation reaction and asymmetric catalytic reaction, etc. In addition, the compound is also widely used in the research of some medical fields, for example, in the application of anti-tumor therapy. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
