68498-25-9
Chemical Structure
N6-Etheno 2'-deoxyadenosine
- CAS No.: 68498-25-9
- Formula:C12H13N5O3
- Molecular Weight:275.27
IUPAC Name: (2R,3S,5R)-2-(hydroxymethyl)-5-(3H-imidazo[2,1-i]purin-3-yl)tetrahydrofuran-3-ol
InChIKey: XQQIMTUYVDUWKJ-DJLDLDEBSA-N
SMILES: O[C@@H](C1)[C@@H](CO)O[C@H]1N(C=N2)C3=C2C4=NC=CN4C=N3
Biological Activity: N6-Etheno 2'-deoxyadenosine is a reactive oxygen species (ROS)/reactive nitrogen species (RNS)-induced DNA oxidation product, used as a biomarker to evaluate chronic inflammation and lipid peroxidation in animal or human tissues[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N6-Etheno 2'-deoxyadenosine | 98.70% | N6-Etheno 2'-deoxyadenosine is a reactive oxygen species (ROS)/reactive nitrogen species (RNS)-induced DNA oxidation product, used as a biomarker to evaluate chronic inflammation and lipid peroxidation in animal or human tissues. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||