6879-02-3
Chemical Structure
Tylocrebrine
- CAS. Nr.: 6879-02-3
- Formula:C24H27NO4
- Molecular Weight:393.48
IUPAC Name: (R)-2,3,5,6-tetramethoxy-9,11,12,13,13a,14-hexahydrodibenzo[f,h]pyrrolo[1,2-b]isoquinoline
InChIKey: YFEPHJVWLFGWKH-CQSZACIVSA-N
SMILES: COC1=C(OC)C=CC2=C(CN3[C@@](CCC3)([H])C4)C4=C(C=C(C(OC)=C5)OC)C5=C12
Biological Activity: Tylocrebrine is a compound with anticancer activity. Its clinical research was interrupted due to toxicity issues. By making it into targeted nanoparticles, its inhibitory index can be improved, the killing effect on tumor cells can be enhanced and brain penetration can be reduced.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tylocrebrine | Tylocrebrine is a compound with anticancer activity. Its clinical research was interrupted due to toxicity issues. By making it into targeted nanoparticles, its inhibitory index can be improved, the killing effect on tumor cells can be enhanced and brain penetration can be reduced. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||