702679-55-8
Chemical Structure
(2S,4R)-Fmoc-L-Pro(4-N3)-OH
- CAS No.: 702679-55-8
- Formula:C20H18N4O4
- Molecular Weight:378.38
IUPAC Name: (2S,4R)-1-(((9H-fluoren-9-yl)methoxy)carbonyl)-4-azidopyrrolidine-2-carboxylic acid
InChIKey: HOPXMBBEYJTPNX-XIKOKIGWSA-N
SMILES: O=C(N1[C@@H](C[C@H](C1)N=[N+]=[N-])C(O)=O)OCC2C3=CC=CC=C3C4=CC=CC=C42
Biological Activity: (2S,4R)-Fmoc-L-Pro(4-N3)-OH is a click chemistry reagent containing an azide[1]. (2S,4R)-Fmoc-L-Pro(4-N3)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(2S,4R)-Fmoc-L-Pro(4-N3)-OH | (2S,4R)-Fmoc-L-Pro(4-N3)-OH is a click chemistry reagent containing an azide. (2S,4R)-Fmoc-L-Pro(4-N3)-OH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||