70616-90-9
Chemical Structure
Reactive orange 4
- CAS No.: 70616-90-9
- Formula:C24H13Cl2N6Na3O10S3
- Molecular Weight:781.46
IUPAC Name: sodium 2-((6-((4,6-dichloro-1,3,5-triazin-2-yl)(methyl)amino)-1-hydroxy-3-sulfonatonaphthalen-2-yl)diazenyl)naphthalene-1,5-disulfonate
InChIKey: ARXWHYHTMGGNST-UHFFFAOYSA-K
SMILES: O=S(C1=C2C=CC=C(S(=O)(O[Na])=O)C2=CC=C1N=NC3=C(S(=O)(O[Na])=O)C=C4C=C(N(C5=NC(Cl)=NC(Cl)=N5)C)C=CC4=C3O)(O[Na])=O
Biological Activity: Reactive orange 4 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Reactive orange 4 | Reactive orange 4 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||