71950-67-9
Chemical Structure
Thielavin B
- CAS No.: 71950-67-9
- Formula:C31H34O10
- Molecular Weight:566.60
IUPAC Name: 4-((4-((2,4-dihydroxy-3,6-dimethylbenzoyl)oxy)-2-methoxy-3,5,6-trimethylbenzoyl)oxy)-2-methoxy-3,5,6-trimethylbenzoic acid
InChIKey: UULGWGARYDGVBM-UHFFFAOYSA-N
SMILES: OC1=C(C(O)=C(C(C)=C1)C(OC2=C(C(C)=C(C(OC)=C2C)C(OC3=C(C(C)=C(C(OC)=C3C)C(O)=O)C)=O)C)=O)C
Biological Activity: Thielavin B is an inhibitor of prostaglandin biosynthesis produced by Thielavia terricola. Thielavin B effectively influences the prostaglandin E2 synthesis from the endoperoxide. Thielavin B is significantly effective on carrageenan-induced oedema of rats when administered intravenously[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Thielavin B | Thielavin B is an inhibitor of prostaglandin biosynthesis produced by Thielavia terricola. Thielavin B effectively influences the prostaglandin E2 synthesis from the endoperoxide. Thielavin B is significantly effective on carrageenan-induced oedema of rats when administered intravenously. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||