72914-19-3
Chemical Structure
tBu2bpy
- CAS No.: 72914-19-3
- Formula:C18H24N2
- Molecular Weight:268.40
IUPAC Name: 4,4'-di-tert-butyl-2,2'-bipyridine
InChIKey: TXNLQUKVUJITMX-UHFFFAOYSA-N
SMILES: N=1C=CC(=CC1C=2N=CC=C(C2)C(C)(C)C)C(C)(C)C
Biological Activity: tBu2bpy is a bidentate nitrogen ligand that coordinates with Pt (II) and Pt (IV) to form functional complexes. The tBu2bpy Pt (II) bis-crown ether complex selectively recognizes Mg2+ and Zn2+; both ions significantly enhance the fluorescence of the complex and cause a blue shift of the absorption peak. Its six-coordinate Pt (IV) complex [Pt (X)2Me2 (tBu2bpy)] inhibits the proliferation of tumor cells. tBu2bpy Pt (IV) complexes bind to DNA through multiple interactions including partial intercalation, groove binding, and electrostatic interaction, and can competitively displace ethidium bromide and covalently bind to purine nucleotides. tBu2bpy can be used in relevant research in fields such as organic synthesis[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
tBu2bpy | 99.08% | tBu2bpy is a bidentate nitrogen ligand that coordinates with Pt (II) and Pt (IV) to form functional complexes. The tBu2bpy Pt (II) bis-crown ether complex selectively recognizes Mg2+ and Zn2+; both ions significantly enhance the fluorescence of the complex and cause a blue shift of the absorption peak. Its six-coordinate Pt (IV) complex [Pt (X)2Me2 (tBu2bpy)] inhibits the proliferation of tumor cells. tBu2bpy Pt (IV) complexes bind to DNA through multiple interactions including partial intercalation, groove binding, and electrostatic interaction, and can competitively displace ethidium bromide and covalently bind to purine nucleotides. tBu2bpy can be used in relevant research in fields such as organic synthesis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Pouryasin Z, et al. Anticancer and DNA binding activities of platinum (IV) complexes; importance of leaving group departure rate. Applied biochemistry and biotechnology. 2014 Mar;172(5):2604-17. [Content Brief]
- [2]. Siu P K M, et al. A Diiminoplatinum(II) Complex of 4-Ethynylbenzo-15-crown-5 as a Luminescent Sensor for Divalent Metal Ions. European Journal of Inorganic Chemistry, 2003, 2003(15): 2749-2752.
Keywords
