73649-05-5
Chemical Structure
Phenazostatin B
- CAS No.: 73649-05-5
- Formula:C32H26N4O4
- Molecular Weight:530.57
InChIKey: WAOUDSYSWNZZKK-QZTJIDSGSA-N
SMILES: C[C@@H](C1=CC=CC2=C1N=C(C=CC=C3C(OC)=O)C3=N2)[C@H](C4=CC=CC5=C4N=C(C=CC=C6C(OC)=O)C6=N5)C
Biological Activity: Phenazostatin B is a phenazine Substance that has the protective effect of new neuron cells. Phenazostatin B can scavenge free radicals, protect N18-RE 105 nerve cells from glutamate toxicity, and inhibit lipid peroxidation. Phenazostatin B inhibits glutamate toxicity in N18-RE-105 cells with an EC50 of 0.33 μg/mL[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Phenazostatin B | Phenazostatin B is a phenazine Substance that has the protective effect of new neuron cells. Phenazostatin B can scavenge free radicals, protect N18-RE 105 nerve cells from glutamate toxicity, and inhibit lipid peroxidation. Phenazostatin B inhibits glutamate toxicity in N18-RE-105 cells with an EC50 of 0.33 μg/mL. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||