75369-61-8
Chemical Structure
5-Hydroxy flunixin
- CAS No.: 75369-61-8
- Formula:C14H11F3N2O3
- Molecular Weight:312.24
IUPAC Name: 5-Hydroxy-2-((2-methyl-3-(trifluoromethyl)phenyl)amino)nicotinic acid
InChIKey: JSXNJGKWSWRIGA-UHFFFAOYSA-N
SMILES: O=C(C1=CC(O)=CN=C1NC2=CC=CC(C(F)(F)F)=C2C)O
Biological Activity: 5-Hydroxy flunixin, the principal metabolite of Flunixin (HY-121046), retains the Flunixin's anti-inflammatory properties and plays a significant role in mitigating pain and inflammation in various veterinary applications. It assists in alleviating conditions such as colic in horses, musculoskeletal disorders, and infectious diseases in cattle, while also supporting the management of mastitis-metritis-agalactia syndrome in sows.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-Hydroxy flunixin | 5-Hydroxy flunixin, the principal metabolite of Flunixin (HY-121046), retains the Flunixin's anti-inflammatory properties and plays a significant role in mitigating pain and inflammation in various veterinary applications. It assists in alleviating conditions such as colic in horses, musculoskeletal disorders, and infectious diseases in cattle, while also supporting the management of mastitis-metritis-agalactia syndrome in sows. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5-Hydroxy flunixin (Standard) | ≥98% | 5-Hydroxy flunixin (Standard) is the analytical standard of 5-Hydroxy flunixin. This product is intended for research and analytical applications. 5-Hydroxy flunixin, the principal metabolite of Flunixin (HY-121046), retains the Flunixin's anti-inflammatory properties and plays a significant role in mitigating pain and inflammation in various veterinary applications. It assists in alleviating conditions such as colic in horses, musculoskeletal disorders, and infectious diseases in cattle, while also supporting the management of mastitis-metritis-agalactia syndrome in sows. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
5-Hydroxy flunixin-d3 (Major) | 5-Hydroxy flunixin-d3 (Major) is the deuterium labeled 5-Hydroxy flunixin (Major). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
