76996-28-6
Chemical Structure
Garcinone B
- CAS No.: 76996-28-6
- Formula:C23H22O6
- Molecular Weight:394.42
InChIKey: HVXHJNVYRXRHNX-UHFFFAOYSA-N
SMILES: OC(C(C/C=C(C)/C)=C1O)=CC2=C1C(C3=C4C(OC(C)(C)C=C4)=C(O)C=C3O2)=O
Biological Activity: Garcinone B, a xanthone derivative, is a nature product that could be isolated from the pericarp of Mangosteen. Garcinone B is a potent ACE2 and Mpro inhibitor. Garcinone B can be used in research of COVID-19[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Garcinone B | Garcinone B, a xanthone derivative, is a nature product that could be isolated from the pericarp of Mangosteen. Garcinone B is a potent ACE2 and Mpro inhibitor. Garcinone B can be used in research of COVID-19. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords