83156-04-1
Chemical Structure
Angelol B
- CAS No.: 83156-04-1
- Formula:C20H24O7
- Molecular Weight:376.40
IUPAC Name: (1R,2S)-1,3-dihydroxy-1-(7-methoxy-2-oxo-2H-chromen-6-yl)-3-methylbutan-2-yl (E)-2-methylbut-2-enoate
InChIKey: GFMYIOGFYYHKLA-ZRKIHGRPSA-N
SMILES: C/C=C(C)/C(O[C@@H]([C@H](O)C1=C(OC)C=C(O2)C(C=CC2=O)=C1)C(C)(O)C)=O
Biological Activity: Angelol B is a coumarin isolated from the roots of Angelica pubescens f. biserrata, which is passive diffusion as the dominating process in Caco-2 cell monolayer model[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Angelol B | Angelol B is a coumarin isolated from the roots of Angelica pubescens f. biserrata, which is passive diffusion as the dominating process in Caco-2 cell monolayer model. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||