858360-57-3
Chemical Structure
Marsdenoside B
- CAS. Nr.: 858360-57-3
- Formula:C45H68O14
- Molecular Weight:833.01
InChIKey: VQJMXGXETFHHGG-RNHLGJFBSA-N
SMILES: C[C@@]12[C@]3(CC[C@H]2C(C)=O)[C@]4([C@]([C@@]5([C@@](C[C@H](CC5)O[C@H]6C[C@H]([C@@H]([C@H](O6)C)O[C@H]7[C@@H]([C@@H]([C@@H]([C@H](O7)C)O)OC)O)OC)([H])CC4)C)([H])[C@@H]([C@H]1OC(/C(C)=C/C)=O)OC(/C(C)=C/C)=O)O3
Biological Activity: Marsdenoside B (compound 8) is a Marsdenoside isolated from Alocasia genus. Marsdenoside B inhibits the growth of tumor cell lines MGC-803 and HT-29 with IC50s of 25.6 μg/mL and 32.4 μg/mL, respectively.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Marsdenoside B | Marsdenoside B (compound 8) is a Marsdenoside isolated from Alocasia genus. Marsdenoside B inhibits the growth of tumor cell lines MGC-803 and HT-29 with IC50s of 25.6 μg/mL and 32.4 μg/mL, respectively. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||