861243-71-2
Chemical Structure
MSP-1 P2
- CAS No.: 861243-71-2
- Formula:C116H190N32O35S
- Molecular Weight:2625.01
SMILES: O=C(N[C@@H](CC1=CC=C(C=C1)O)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCCN)C(N2[C@@H](CCC2)C(N[C@@H](CC(C)C)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(N)=O)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](CCCCN)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(N)=O)C(N[C@@H](C(C)C)C(NCC(N[C@@H](CCCCN)C(N[C@@H](CCSC)C(N[C@@H](CCC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@@H](CC3=CC=C(C=C3)O)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](CCCCN)C(N[C@@H](CCCCN)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)CN
Biological Activity:
MSP-1 P2 is a synthetic peptide of merozoite surface protein-1 (MSP-1). MSP-1 P2 stimulates umbilical cord blood lymphocytes to produce IFN-γ and IL-13, and this immune response is primarily mediated by CD4+ T cells. MSP-1 P2 can be used as a specific antigen stimulus to detect T cell responses and cytokine levels[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
MSP-1 P2 | MSP-1 P2 is a synthetic peptide of merozoite surface protein-1 (MSP-1). MSP-1 P2 stimulates umbilical cord blood lymphocytes to produce IFN-γ and IL-13, and this immune response is primarily mediated by CD4+ T cells. MSP-1 P2 can be used as a specific antigen stimulus to detect T cell responses and cytokine levels. |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||