86408-36-8
Chemical Structure
Polymyxin B nonapeptide
- CAS No.: 86408-36-8
- Formula:C43H74N14O11
- Molecular Weight:963.13
IUPAC Name: (2S,3R)-2-amino-N-((S)-4-amino-1-oxo-1-(((3S,6S,9S,12S,15R,18S,21S)-6,9,18-tris(2-aminoethyl)-15-benzyl-3-((R)-1-hydroxyethyl)-12-isobutyl-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptaazacyclotricosan-21-yl)amino)butan-2-yl)-3-hydroxybutanamide
InChIKey: PYHYGIPVYYRJHU-QWDNBKTCSA-N
SMILES: O=C(N[C@H](C(N[C@@](C(N[C@H](C(N[C@]([C@H](O)C)([H])C(NCC[C@@](NC([C@H](CCN)NC([C@@H](N)[C@H](O)C)=O)=O)([H])C(N[C@@H](CCN)C1=O)=O)=O)=O)CCN)=O)([H])CCN)=O)CC(C)C)[C@H](N1)CC2=CC=CC=C2
Biological Activity: Polymyxin B nonapeptide is a cyclic peptide obtained from Polymyxin B by proteolytic removal of its terminal amino acyl residue. Polymyxin B nonapeptide is less toxic, lacks bactericidal activity, and retains its ability to render gram-negative bacteria susceptible to several antibiotics by permeabilizing their outer membranes[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Polymyxin B nonapeptide | 99.83% | Polymyxin B nonapeptide is a cyclic peptide obtained from Polymyxin B by proteolytic removal of its terminal amino acyl residue. Polymyxin B nonapeptide is less toxic, lacks bactericidal activity, and retains its ability to render gram-negative bacteria susceptible to several antibiotics by permeabilizing their outer membranes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Polymyxin B nonapeptide (Standard) | ≥98% | Polymyxin B nonapeptide (Standard) is the analytical standard of Polymyxin B nonapeptide. This product is intended for research and analytical applications. Polymyxin B nonapeptide is a cyclic peptide obtained from Polymyxin B by proteolytic removal of its terminal amino acyl residue. Polymyxin B nonapeptide is less toxic, lacks bactericidal activity, and retains its ability to render gram-negative bacteria susceptible to several antibiotics by permeabilizing their outer membranes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Al-Marzooq F, et al. Discerning the role of polymyxin B nonapeptide in restoring the antibacterial activity of azithromycin against antibiotic-resistant Escherichia coli. Front Microbiol. 2022 Sep 21;13:998671. [Content Brief]
- [2]. Danner RL,et al. Purification, toxicity, and antiendotoxin activity of polymyxin B nonapeptide. Antimicrob Agents Chemother. 1989 Sep;33(9):1428-34. [Content Brief]
- [3]. Ofek I, et al. Antibacterial synergism of polymyxin B nonapeptide and hydrophobic antibiotics in experimental gram-negative infections in mice. Antimicrob Agents Chemother. 1994 Feb;38(2):374-7. [Content Brief]